C26H27NS — CID 170679055
4,4,7,7,9-pentamethyl-15-phenyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene (PubChem CID 170679055) has the molecular formula C26H27NS and a molecular weight of 385.58 g/mol. Its IUPAC name is 4,4,7,7,9-pentamethyl-15-phenyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene.
| Compound Name | 4,4,7,7,9-pentamethyl-15-phenyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 170679055 |
| Molecular Formula | C26H27NS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4,4,7,7,9-pentamethyl-15-phenyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene |
| SMILES | Cc1c2c(cc3sc4c(-c5ccccc5)nccc4c13)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H27NS/c1-16-21-18-11-14-27-23(17-9-7-6-8-10-17)24(18)28-20(21)15-19-22(16)26(4,5)13-12-25(19,2)3/h6-11,14-15H,12-13H2,1-5H3 |
| InChIKey | ZZGLZVKSPHYSJN-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |