C34H34N2S — CID 170679258
15-(4-tert-butylnaphthalen-2-yl)-9-isocyano-3,3,6,6-tetramethyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1,7,9,11(16),12,14-hexaene (PubChem CID 170679258) has the molecular formula C34H34N2S and a molecular weight of 502.73 g/mol. Its IUPAC name is 15-(4-tert-butylnaphthalen-2-yl)-9-isocyano-3,3,6,6-tetramethyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1,7,9,11(16),12,14-hexaene.
| Compound Name | 15-(4-tert-butylnaphthalen-2-yl)-9-isocyano-3,3,6,6-tetramethyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1,7,9,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 170679258 |
| Molecular Formula | C34H34N2S |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 15-(4-tert-butylnaphthalen-2-yl)-9-isocyano-3,3,6,6-tetramethyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1,7,9,11(16),12,14-hexaene |
| SMILES | [C-]#[N+]c1cc2c(c3sc4c(-c5cc(C(C)(C)C)c6ccccc6c5)nccc4c13)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H34N2S/c1-32(2,3)24-18-21(17-20-11-9-10-12-22(20)24)29-30-23(13-16-36-29)27-26(35-8)19-25-28(31(27)37-30)34(6,7)15-14-33(25,4)5/h9-13,16-19H,14-15H2,1-7H3 |
| InChIKey | LITSBPHHOOYIJT-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|