C34H37NS — CID 170678793
15-(4-tert-butylnaphthalen-2-yl)-4,4,7,7,9-pentamethyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene (PubChem CID 170678793) has the molecular formula C34H37NS and a molecular weight of 491.74 g/mol. Its IUPAC name is 15-(4-tert-butylnaphthalen-2-yl)-4,4,7,7,9-pentamethyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene.
| Compound Name | 15-(4-tert-butylnaphthalen-2-yl)-4,4,7,7,9-pentamethyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 170678793 |
| Molecular Formula | C34H37NS |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 15-(4-tert-butylnaphthalen-2-yl)-4,4,7,7,9-pentamethyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12,14-hexaene |
| SMILES | Cc1c2c(cc3sc4c(-c5cc(C(C)(C)C)c6ccccc6c5)nccc4c13)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H37NS/c1-20-28-24-13-16-35-30(22-17-21-11-9-10-12-23(21)25(18-22)32(2,3)4)31(24)36-27(28)19-26-29(20)34(7,8)15-14-33(26,5)6/h9-13,16-19H,14-15H2,1-8H3 |
| InChIKey | YRRHZRFIGBUOGA-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |