C34H37NSe — CID 176779844
15-(4-tert-butylnaphthalen-2-yl)-3,3,6,6,9-pentamethyl-17-selena-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene (PubChem CID 176779844) has the molecular formula C34H37NSe and a molecular weight of 538.64 g/mol. Its IUPAC name is 15-(4-tert-butylnaphthalen-2-yl)-3,3,6,6,9-pentamethyl-17-selena-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene.
| Compound Name | 15-(4-tert-butylnaphthalen-2-yl)-3,3,6,6,9-pentamethyl-17-selena-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 176779844 |
| Molecular Formula | C34H37NSe |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 15-(4-tert-butylnaphthalen-2-yl)-3,3,6,6,9-pentamethyl-17-selena-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
| SMILES | Cc1cc2c(c3[se]c4c(-c5cc(C(C)(C)C)c6ccccc6c5)nccc4c13)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H37NSe/c1-20-17-26-28(34(7,8)15-14-33(26,5)6)31-27(20)24-13-16-35-29(30(24)36-31)22-18-21-11-9-10-12-23(21)25(19-22)32(2,3)4/h9-13,16-19H,14-15H2,1-8H3 |
| InChIKey | LCRRVUDBKQJOHB-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|