C34H39NSeSi — CID 176802724
1-(4-tert-butylnaphthalen-2-yl)-7-[(1,1-dimethylsilinan-4-yl)methyl]-8-methyl-[1]benzoselenolo[2,3-c]pyridine (PubChem CID 176802724) has the molecular formula C34H39NSeSi and a molecular weight of 568.74 g/mol. Its IUPAC name is 1-(4-tert-butylnaphthalen-2-yl)-7-[(1,1-dimethylsilinan-4-yl)methyl]-8-methyl-[1]benzoselenolo[2,3-c]pyridine.
| Compound Name | 1-(4-tert-butylnaphthalen-2-yl)-7-[(1,1-dimethylsilinan-4-yl)methyl]-8-methyl-[1]benzoselenolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 176802724 |
| Molecular Formula | C34H39NSeSi |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 1-(4-tert-butylnaphthalen-2-yl)-7-[(1,1-dimethylsilinan-4-yl)methyl]-8-methyl-[1]benzoselenolo[2,3-c]pyridine |
| SMILES | Cc1c(CC2CC[Si](C)(C)CC2)ccc2c1[se]c1c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C34H39NSeSi/c1-22-24(19-23-14-17-37(5,6)18-15-23)11-12-28-29-13-16-35-31(33(29)36-32(22)28)26-20-25-9-7-8-10-27(25)30(21-26)34(2,3)4/h7-13,16,20-21,23H,14-15,17-19H2,1-6H3 |
| InChIKey | RNGZADODUSPRFH-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|