C27H28N2Se2 — CID 167427597
9-(4-tert-butylnaphthalen-2-yl)-4-(2,2-dimethylpropyl)-5,7-diselena-3,10-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,9,11-pentaene (PubChem CID 167427597) has the molecular formula C27H28N2Se2 and a molecular weight of 538.46 g/mol. Its IUPAC name is 9-(4-tert-butylnaphthalen-2-yl)-4-(2,2-dimethylpropyl)-5,7-diselena-3,10-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,9,11-pentaene.
| Compound Name | 9-(4-tert-butylnaphthalen-2-yl)-4-(2,2-dimethylpropyl)-5,7-diselena-3,10-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,9,11-pentaene |
|---|---|
| PubChem CID | 167427597 |
| Molecular Formula | C27H28N2Se2 |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 9-(4-tert-butylnaphthalen-2-yl)-4-(2,2-dimethylpropyl)-5,7-diselena-3,10-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3,9,11-pentaene |
| SMILES | CC(C)(C)Cc1nc2c([se]1)[se]c1c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C27H28N2Se2/c1-26(2,3)15-21-29-23-19-11-12-28-22(24(19)31-25(23)30-21)17-13-16-9-7-8-10-18(16)20(14-17)27(4,5)6/h7-14H,15H2,1-6H3 |
| InChIKey | AIYRXUXRYSJNHS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|