C31H32N2 — CID 156667246
7-(4-tert-butylnaphthalen-2-yl)-4-(2,2-dimethylpropyl)-1,8-phenanthroline (PubChem CID 156667246) has the molecular formula C31H32N2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 7-(4-tert-butylnaphthalen-2-yl)-4-(2,2-dimethylpropyl)-1,8-phenanthroline.
| Compound Name | 7-(4-tert-butylnaphthalen-2-yl)-4-(2,2-dimethylpropyl)-1,8-phenanthroline |
|---|---|
| PubChem CID | 156667246 |
| Molecular Formula | C31H32N2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 7-(4-tert-butylnaphthalen-2-yl)-4-(2,2-dimethylpropyl)-1,8-phenanthroline |
| SMILES | CC(C)(C)Cc1ccnc2c1ccc1c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C31H32N2/c1-30(2,3)19-21-13-15-33-29-24(21)11-12-25-26(29)14-16-32-28(25)22-17-20-9-7-8-10-23(20)27(18-22)31(4,5)6/h7-18H,19H2,1-6H3 |
| InChIKey | LTKZQFKVYHRVSO-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|