C25H21NOSi — CID 172528319
1-(4-tert-butylnaphthalen-2-yl)-[1]benzosilolo[2,3-c]pyridine 9-oxide (PubChem CID 172528319) has the molecular formula C25H21NOSi and a molecular weight of 379.54 g/mol. Its IUPAC name is 1-(4-tert-butylnaphthalen-2-yl)-[1]benzosilolo[2,3-c]pyridine 9-oxide.
| Compound Name | 1-(4-tert-butylnaphthalen-2-yl)-[1]benzosilolo[2,3-c]pyridine 9-oxide |
|---|---|
| PubChem CID | 172528319 |
| Molecular Formula | C25H21NOSi |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-(4-tert-butylnaphthalen-2-yl)-[1]benzosilolo[2,3-c]pyridine 9-oxide |
| SMILES | CC(C)(C)c1cc(-c2nccc3c2[Si](=O)c2ccccc2-3)cc2ccccc12 |
| InChI | InChI=1S/C25H21NOSi/c1-25(2,3)21-15-17(14-16-8-4-5-9-18(16)21)23-24-20(12-13-26-23)19-10-6-7-11-22(19)28(24)27/h4-15H,1-3H3 |
| InChIKey | OYRRYJNDECYDJB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|