C30H35GeNSi — CID 171747954
[1-(4-tert-butylnaphthalen-2-yl)-9,9-dimethyl-[1]benzosilolo[2,3-c]pyridin-7-yl]-trimethylgermane (PubChem CID 171747954) has the molecular formula C30H35GeNSi and a molecular weight of 510.31 g/mol. Its IUPAC name is [1-(4-tert-butylnaphthalen-2-yl)-9,9-dimethyl-[1]benzosilolo[2,3-c]pyridin-7-yl]-trimethylgermane.
| Compound Name | [1-(4-tert-butylnaphthalen-2-yl)-9,9-dimethyl-[1]benzosilolo[2,3-c]pyridin-7-yl]-trimethylgermane |
|---|---|
| PubChem CID | 171747954 |
| Molecular Formula | C30H35GeNSi |
| Molecular Weight | 510.31 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | [1-(4-tert-butylnaphthalen-2-yl)-9,9-dimethyl-[1]benzosilolo[2,3-c]pyridin-7-yl]-trimethylgermane |
| SMILES | CC(C)(C)c1cc(-c2nccc3c2[Si](C)(C)c2cc([Ge](C)(C)C)ccc2-3)cc2ccccc12 |
| InChI | InChI=1S/C30H35GeNSi/c1-30(2,3)26-18-21(17-20-11-9-10-12-23(20)26)28-29-25(15-16-32-28)24-14-13-22(31(4,5)6)19-27(24)33(29,7)8/h9-19H,1-8H3 |
| InChIKey | CDIQOZKPYCCPJA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.31 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|