C28H31GeN — CID 171764449
[4-[2-(4-tert-butylnaphthalen-2-yl)-4-pyridinyl]phenyl]-trimethylgermane (PubChem CID 171764449) has the molecular formula C28H31GeN and a molecular weight of 454.17 g/mol. Its IUPAC name is [4-[2-(4-tert-butylnaphthalen-2-yl)-4-pyridinyl]phenyl]-trimethylgermane.
| Compound Name | [4-[2-(4-tert-butylnaphthalen-2-yl)-4-pyridinyl]phenyl]-trimethylgermane |
|---|---|
| PubChem CID | 171764449 |
| Molecular Formula | C28H31GeN |
| Molecular Weight | 454.17 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | [4-[2-(4-tert-butylnaphthalen-2-yl)-4-pyridinyl]phenyl]-trimethylgermane |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccc([Ge](C)(C)C)cc3)ccn2)cc2ccccc12 |
| InChI | InChI=1S/C28H31GeN/c1-28(2,3)26-18-23(17-22-9-7-8-10-25(22)26)27-19-21(15-16-30-27)20-11-13-24(14-12-20)29(4,5)6/h7-19H,1-6H3 |
| InChIKey | QPHRPFYSQUQLBM-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.17 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |