C30H31GeNO — CID 168743775
[2-[2-(4-tert-butylnaphthalen-2-yl)-4-pyridinyl]-1-benzofuran-5-yl]-trimethylgermane (PubChem CID 168743775) has the molecular formula C30H31GeNO and a molecular weight of 494.19 g/mol. Its IUPAC name is [2-[2-(4-tert-butylnaphthalen-2-yl)-4-pyridinyl]-1-benzofuran-5-yl]-trimethylgermane.
| Compound Name | [2-[2-(4-tert-butylnaphthalen-2-yl)-4-pyridinyl]-1-benzofuran-5-yl]-trimethylgermane |
|---|---|
| PubChem CID | 168743775 |
| Molecular Formula | C30H31GeNO |
| Molecular Weight | 494.19 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | [2-[2-(4-tert-butylnaphthalen-2-yl)-4-pyridinyl]-1-benzofuran-5-yl]-trimethylgermane |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc4cc([Ge](C)(C)C)ccc4o3)ccn2)cc2ccccc12 |
| InChI | InChI=1S/C30H31GeNO/c1-30(2,3)26-17-22(15-20-9-7-8-10-25(20)26)27-18-21(13-14-32-27)29-19-23-16-24(31(4,5)6)11-12-28(23)33-29/h7-19H,1-6H3 |
| InChIKey | CNDYCIXHLWVXFF-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.19 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |