C26H22N2O — CID 171741463
4-(1-benzofuran-2-yl)-6-(4-tert-butylnaphthalen-2-yl)pyrimidine (PubChem CID 171741463) has the molecular formula C26H22N2O and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-6-(4-tert-butylnaphthalen-2-yl)pyrimidine.
| Compound Name | 4-(1-benzofuran-2-yl)-6-(4-tert-butylnaphthalen-2-yl)pyrimidine |
|---|---|
| PubChem CID | 171741463 |
| Molecular Formula | C26H22N2O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-6-(4-tert-butylnaphthalen-2-yl)pyrimidine |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc4ccccc4o3)ncn2)cc2ccccc12 |
| InChI | InChI=1S/C26H22N2O/c1-26(2,3)21-13-19(12-17-8-4-6-10-20(17)21)22-15-23(28-16-27-22)25-14-18-9-5-7-11-24(18)29-25/h4-16H,1-3H3 |
| InChIKey | PHRSZLDWFJHEKJ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |