C21H26GeN2 — CID 177122636
[2-(4-tert-butylnaphthalen-2-yl)pyrimidin-4-yl]-trimethylgermane (PubChem CID 177122636) has the molecular formula C21H26GeN2 and a molecular weight of 379.06 g/mol. Its IUPAC name is [2-(4-tert-butylnaphthalen-2-yl)pyrimidin-4-yl]-trimethylgermane.
| Compound Name | [2-(4-tert-butylnaphthalen-2-yl)pyrimidin-4-yl]-trimethylgermane |
|---|---|
| PubChem CID | 177122636 |
| Molecular Formula | C21H26GeN2 |
| Molecular Weight | 379.06 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [2-(4-tert-butylnaphthalen-2-yl)pyrimidin-4-yl]-trimethylgermane |
| SMILES | CC(C)(C)c1cc(-c2nccc([Ge](C)(C)C)n2)cc2ccccc12 |
| InChI | InChI=1S/C21H26GeN2/c1-21(2,3)18-14-16(13-15-9-7-8-10-17(15)18)20-23-12-11-19(24-20)22(4,5)6/h7-14H,1-6H3 |
| InChIKey | TYVFAIDVTFBVAF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.06 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |