C31H29NSi — CID 167354672
6-(4-tert-butylnaphthalen-2-yl)-11,11-dimethyl-[1]benzosilolo[3,2-c]quinoline (PubChem CID 167354672) has the molecular formula C31H29NSi and a molecular weight of 443.67 g/mol. Its IUPAC name is 6-(4-tert-butylnaphthalen-2-yl)-11,11-dimethyl-[1]benzosilolo[3,2-c]quinoline.
| Compound Name | 6-(4-tert-butylnaphthalen-2-yl)-11,11-dimethyl-[1]benzosilolo[3,2-c]quinoline |
|---|---|
| PubChem CID | 167354672 |
| Molecular Formula | C31H29NSi |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 6-(4-tert-butylnaphthalen-2-yl)-11,11-dimethyl-[1]benzosilolo[3,2-c]quinoline |
| SMILES | CC(C)(C)c1cc(-c2nc3ccccc3c3c2-c2ccccc2[Si]3(C)C)cc2ccccc12 |
| InChI | InChI=1S/C31H29NSi/c1-31(2,3)25-19-21(18-20-12-6-7-13-22(20)25)29-28-24-15-9-11-17-27(24)33(4,5)30(28)23-14-8-10-16-26(23)32-29/h6-19H,1-5H3 |
| InChIKey | PKLIZGFHYWVITN-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|