C36H30Si2 — CID 171742945
3,3,24,24-tetramethyl-7-naphthalen-2-yl-3,24-disilahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22-undecaene (PubChem CID 171742945) has the molecular formula C36H30Si2 and a molecular weight of 518.81 g/mol. Its IUPAC name is 3,3,24,24-tetramethyl-7-naphthalen-2-yl-3,24-disilahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22-undecaene.
| Compound Name | 3,3,24,24-tetramethyl-7-naphthalen-2-yl-3,24-disilahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22-undecaene |
|---|---|
| PubChem CID | 171742945 |
| Molecular Formula | C36H30Si2 |
| Molecular Weight | 518.81 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 3,3,24,24-tetramethyl-7-naphthalen-2-yl-3,24-disilahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22-undecaene |
| SMILES | C[Si]1(C)c2ccccc2-c2c1c1c(c3ccccc23)-c2cc(-c3ccc4ccccc4c3)ccc2[Si]1(C)C |
| InChI | InChI=1S/C36H30Si2/c1-37(2)31-16-10-9-15-29(31)33-27-13-7-8-14-28(27)34-30-22-26(19-20-32(30)38(3,4)36(34)35(33)37)25-18-17-23-11-5-6-12-24(23)21-25/h5-22H,1-4H3 |
| InChIKey | XGSGUMJDGXEPOM-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.81 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|