C45H33N3Si — CID 170927900
2-[4-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)phenyl]-4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazine (PubChem CID 170927900) has the molecular formula C45H33N3Si and a molecular weight of 643.87 g/mol. Its IUPAC name is 2-[4-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)phenyl]-4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)phenyl]-4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 170927900 |
| Molecular Formula | C45H33N3Si |
| Molecular Weight | 643.87 g/mol |
| Exact Mass | 643.24 |
| IUPAC Name | 2-[4-(5,5-dimethylbenzo[b][1]benzosilol-1-yl)phenyl]-4-(4-naphthalen-2-ylphenyl)-6-phenyl-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccccc2-c2c(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccc7ccccc7c6)cc5)n4)cc3)cccc21 |
| InChI | InChI=1S/C45H33N3Si/c1-49(2)40-17-9-8-15-39(40)42-38(16-10-18-41(42)49)32-22-26-35(27-23-32)45-47-43(33-12-4-3-5-13-33)46-44(48-45)34-24-19-31(20-25-34)37-28-21-30-11-6-7-14-36(30)29-37/h3-29H,1-2H3 |
| InChIKey | IYAAZKMJYUQUHP-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.87 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|