C49H35N3Si — CID 158354834
2-(7,7-dimethylnaphtho[2,1-b][1]benzosilol-9-yl)-4-(6-phenylnaphthalen-2-yl)-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 158354834) has the molecular formula C49H35N3Si and a molecular weight of 693.93 g/mol. Its IUPAC name is 2-(7,7-dimethylnaphtho[2,1-b][1]benzosilol-9-yl)-4-(6-phenylnaphthalen-2-yl)-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(7,7-dimethylnaphtho[2,1-b][1]benzosilol-9-yl)-4-(6-phenylnaphthalen-2-yl)-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 158354834 |
| Molecular Formula | C49H35N3Si |
| Molecular Weight | 693.93 g/mol |
| Exact Mass | 693.26 |
| IUPAC Name | 2-(7,7-dimethylnaphtho[2,1-b][1]benzosilol-9-yl)-4-(6-phenylnaphthalen-2-yl)-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | C[Si]1(C)c2cc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc5cc(-c6ccccc6)ccc5c4)n3)ccc2-c2c1ccc1ccccc21 |
| InChI | InChI=1S/C49H35N3Si/c1-53(2)44-28-26-35-15-9-10-16-42(35)46(44)43-27-25-41(31-45(43)53)49-51-47(36-19-17-34(18-20-36)32-11-5-3-6-12-32)50-48(52-49)40-24-23-38-29-37(21-22-39(38)30-40)33-13-7-4-8-14-33/h3-31H,1-2H3 |
| InChIKey | GBQAMEKXNUAWEG-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.93 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|