C46H34N2Si — CID 140785887
11,11-dimethyl-14-phenyl-16-[3-[3-(4-phenylphenyl)phenyl]phenyl]-13,15-diaza-11-silatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaene (PubChem CID 140785887) has the molecular formula C46H34N2Si and a molecular weight of 642.88 g/mol. Its IUPAC name is 11,11-dimethyl-14-phenyl-16-[3-[3-(4-phenylphenyl)phenyl]phenyl]-13,15-diaza-11-silatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaene.
| Compound Name | 11,11-dimethyl-14-phenyl-16-[3-[3-(4-phenylphenyl)phenyl]phenyl]-13,15-diaza-11-silatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
|---|---|
| PubChem CID | 140785887 |
| Molecular Formula | C46H34N2Si |
| Molecular Weight | 642.88 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | 11,11-dimethyl-14-phenyl-16-[3-[3-(4-phenylphenyl)phenyl]phenyl]-13,15-diaza-11-silatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| SMILES | C[Si]1(C)c2ccc3ccccc3c2-c2c(-c3cccc(-c4cccc(-c5ccc(-c6ccccc6)cc5)c4)c3)nc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C46H34N2Si/c1-49(2)41-28-27-34-15-9-10-22-40(34)42(41)43-44(47-45(48-46(43)49)35-16-7-4-8-17-35)39-21-12-20-38(30-39)37-19-11-18-36(29-37)33-25-23-32(24-26-33)31-13-5-3-6-14-31/h3-30H,1-2H3 |
| InChIKey | WHXBDEXFWVGQKA-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.88 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|