C50H36N2Si — CID 140785893
17,17-dimethyl-12-naphthalen-1-yl-14-[3-[3-(4-phenylphenyl)phenyl]phenyl]-13,15-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 140785893) has the molecular formula C50H36N2Si and a molecular weight of 692.94 g/mol. Its IUPAC name is 17,17-dimethyl-12-naphthalen-1-yl-14-[3-[3-(4-phenylphenyl)phenyl]phenyl]-13,15-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | 17,17-dimethyl-12-naphthalen-1-yl-14-[3-[3-(4-phenylphenyl)phenyl]phenyl]-13,15-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 140785893 |
| Molecular Formula | C50H36N2Si |
| Molecular Weight | 692.94 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | 17,17-dimethyl-12-naphthalen-1-yl-14-[3-[3-(4-phenylphenyl)phenyl]phenyl]-13,15-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C[Si]1(C)c2cc3ccccc3cc2-c2c(-c3cccc4ccccc34)nc(-c3cccc(-c4cccc(-c5ccc(-c6ccccc6)cc5)c4)c3)nc21 |
| InChI | InChI=1S/C50H36N2Si/c1-53(2)46-32-41-17-7-6-16-40(41)31-45(46)47-48(44-24-12-18-36-15-8-9-23-43(36)44)51-49(52-50(47)53)42-22-11-21-39(30-42)38-20-10-19-37(29-38)35-27-25-34(26-28-35)33-13-4-3-5-14-33/h3-32H,1-2H3 |
| InChIKey | VSHWJZFHGZRNIO-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.94 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|