C60H44N2Si — CID 140763831
9,9-dimethyl-2,4-bis[3-[3-(4-phenylphenyl)phenyl]phenyl]-[1]benzosilolo[2,3-d]pyrimidine (PubChem CID 140763831) has the molecular formula C60H44N2Si and a molecular weight of 821.11 g/mol. Its IUPAC name is 9,9-dimethyl-2,4-bis[3-[3-(4-phenylphenyl)phenyl]phenyl]-[1]benzosilolo[2,3-d]pyrimidine.
| Compound Name | 9,9-dimethyl-2,4-bis[3-[3-(4-phenylphenyl)phenyl]phenyl]-[1]benzosilolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 140763831 |
| Molecular Formula | C60H44N2Si |
| Molecular Weight | 821.11 g/mol |
| Exact Mass | 820.33 |
| IUPAC Name | 9,9-dimethyl-2,4-bis[3-[3-(4-phenylphenyl)phenyl]phenyl]-[1]benzosilolo[2,3-d]pyrimidine |
| SMILES | C[Si]1(C)c2ccccc2-c2c(-c3cccc(-c4cccc(-c5ccc(-c6ccccc6)cc5)c4)c3)nc(-c3cccc(-c4cccc(-c5ccc(-c6ccccc6)cc5)c4)c3)nc21 |
| InChI | InChI=1S/C60H44N2Si/c1-63(2)56-28-10-9-27-55(56)57-58(53-25-13-23-51(39-53)49-21-11-19-47(37-49)45-33-29-43(30-34-45)41-15-5-3-6-16-41)61-59(62-60(57)63)54-26-14-24-52(40-54)50-22-12-20-48(38-50)46-35-31-44(32-36-46)42-17-7-4-8-18-42/h3-40H,1-2H3 |
| InChIKey | YETXRBUHFFEVRS-UHFFFAOYSA-N |
| XLogP | 14.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.11 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|