C52H38N4Si — CID 140747429
2-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine (PubChem CID 140747429) has the molecular formula C52H38N4Si and a molecular weight of 746.99 g/mol. Its IUPAC name is 2-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine.
| Compound Name | 2-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 140747429 |
| Molecular Formula | C52H38N4Si |
| Molecular Weight | 746.99 g/mol |
| Exact Mass | 746.29 |
| IUPAC Name | 2-[3-[3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine |
| SMILES | C[Si]1(C)c2ccccc2-c2c(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)cc(-c7ccccc7)n6)c5)c4)c3)nc21 |
| InChI | InChI=1S/C52H38N4Si/c1-57(2)47-30-13-12-29-44(47)48-49(37-21-10-5-11-22-37)55-51(56-52(48)57)43-28-16-26-41(33-43)39-24-14-23-38(31-39)40-25-15-27-42(32-40)50-53-45(35-17-6-3-7-18-35)34-46(54-50)36-19-8-4-9-20-36/h3-34H,1-2H3 |
| InChIKey | FVYDJNDBOFVOKC-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.99 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|