C43H31N3OSi — CID 140747446
2-[3-[3-[3-(9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidin-2-yl)phenyl]phenyl]phenyl]-1,3-benzoxazole (PubChem CID 140747446) has the molecular formula C43H31N3OSi and a molecular weight of 633.83 g/mol. Its IUPAC name is 2-[3-[3-[3-(9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidin-2-yl)phenyl]phenyl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[3-[3-[3-(9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidin-2-yl)phenyl]phenyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 140747446 |
| Molecular Formula | C43H31N3OSi |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | 2-[3-[3-[3-(9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidin-2-yl)phenyl]phenyl]phenyl]-1,3-benzoxazole |
| SMILES | C[Si]1(C)c2ccccc2-c2c(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cccc(-c6nc7ccccc7o6)c5)c4)c3)nc21 |
| InChI | InChI=1S/C43H31N3OSi/c1-48(2)38-24-9-6-21-35(38)39-40(28-13-4-3-5-14-28)45-41(46-43(39)48)33-19-11-17-31(26-33)29-15-10-16-30(25-29)32-18-12-20-34(27-32)42-44-36-22-7-8-23-37(36)47-42/h3-27H,1-2H3 |
| InChIKey | IWNYVFYFQTWLIH-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|