C48H34N2SSi — CID 154010703
2-[3-[3-(3-dibenzothiophen-4-ylphenyl)phenyl]phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine (PubChem CID 154010703) has the molecular formula C48H34N2SSi and a molecular weight of 698.97 g/mol. Its IUPAC name is 2-[3-[3-(3-dibenzothiophen-4-ylphenyl)phenyl]phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine.
| Compound Name | 2-[3-[3-(3-dibenzothiophen-4-ylphenyl)phenyl]phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 154010703 |
| Molecular Formula | C48H34N2SSi |
| Molecular Weight | 698.97 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | 2-[3-[3-(3-dibenzothiophen-4-ylphenyl)phenyl]phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine |
| SMILES | C[Si]1(C)c2ccccc2-c2c(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cccc(-c6cccc7c6sc6ccccc67)c5)c4)c3)nc21 |
| InChI | InChI=1S/C48H34N2SSi/c1-52(2)43-27-9-7-23-41(43)44-45(31-14-4-3-5-15-31)49-47(50-48(44)52)37-21-12-19-35(30-37)33-17-10-16-32(28-33)34-18-11-20-36(29-34)38-24-13-25-40-39-22-6-8-26-42(39)51-46(38)40/h3-30H,1-2H3 |
| InChIKey | PIPYLKQQMBKMLI-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.97 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|