C44H34SSi2 — CID 171742610
4-[3-(9,9,21,21-tetramethyl-9,21-disilahexacyclo[11.11.0.02,10.03,8.014,22.015,20]tetracosa-1(13),2(10),3(8),4,6,11,14(22),15,17,19,23-undecaen-6-yl)phenyl]dibenzothiophene (PubChem CID 171742610) has the molecular formula C44H34SSi2 and a molecular weight of 651.00 g/mol. Its IUPAC name is 4-[3-(9,9,21,21-tetramethyl-9,21-disilahexacyclo[11.11.0.02,10.03,8.014,22.015,20]tetracosa-1(13),2(10),3(8),4,6,11,14(22),15,17,19,23-undecaen-6-yl)phenyl]dibenzothiophene.
| Compound Name | 4-[3-(9,9,21,21-tetramethyl-9,21-disilahexacyclo[11.11.0.02,10.03,8.014,22.015,20]tetracosa-1(13),2(10),3(8),4,6,11,14(22),15,17,19,23-undecaen-6-yl)phenyl]dibenzothiophene |
|---|---|
| PubChem CID | 171742610 |
| Molecular Formula | C44H34SSi2 |
| Molecular Weight | 651.00 g/mol |
| Exact Mass | 650.19 |
| IUPAC Name | 4-[3-(9,9,21,21-tetramethyl-9,21-disilahexacyclo[11.11.0.02,10.03,8.014,22.015,20]tetracosa-1(13),2(10),3(8),4,6,11,14(22),15,17,19,23-undecaen-6-yl)phenyl]dibenzothiophene |
| SMILES | C[Si]1(C)c2ccccc2-c2c1ccc1c3c(ccc21)[Si](C)(C)c1cc(-c2cccc(-c4cccc5c4sc4ccccc45)c2)ccc1-3 |
| InChI | InChI=1S/C44H34SSi2/c1-46(2)38-18-8-6-14-35(38)42-32-22-24-40-43(33(32)21-23-39(42)46)36-20-19-28(26-41(36)47(40,3)4)27-11-9-12-29(25-27)30-15-10-16-34-31-13-5-7-17-37(31)45-44(30)34/h5-26H,1-4H3 |
| InChIKey | JTIJNIFQWVDRPV-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.00 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|