C56H40N2Si — CID 140785759
13-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-17,17-dimethyl-15-naphthalen-1-yl-12,14-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 140785759) has the molecular formula C56H40N2Si and a molecular weight of 769.04 g/mol. Its IUPAC name is 13-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-17,17-dimethyl-15-naphthalen-1-yl-12,14-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | 13-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-17,17-dimethyl-15-naphthalen-1-yl-12,14-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 140785759 |
| Molecular Formula | C56H40N2Si |
| Molecular Weight | 769.04 g/mol |
| Exact Mass | 768.30 |
| IUPAC Name | 13-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-17,17-dimethyl-15-naphthalen-1-yl-12,14-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C[Si]1(C)c2cc3ccccc3cc2-c2nc(-c3cccc(-c4cccc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)c4)c3)nc(-c3cccc4ccccc34)c21 |
| InChI | InChI=1S/C56H40N2Si/c1-59(2)52-36-44-22-10-9-21-43(44)35-51(52)54-55(59)53(50-29-15-23-39-20-11-12-28-49(39)50)57-56(58-54)45-27-14-25-41(31-45)40-24-13-26-42(30-40)48-33-46(37-16-5-3-6-17-37)32-47(34-48)38-18-7-4-8-19-38/h3-36H,1-2H3 |
| InChIKey | XBALVLGNZOOROX-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.04 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|