C51H37N5Si — CID 140747498
2-[4-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-5,5-dimethyl-4-phenyl-[1]benzosilolo[3,2-d]pyrimidine (PubChem CID 140747498) has the molecular formula C51H37N5Si and a molecular weight of 747.98 g/mol. Its IUPAC name is 2-[4-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-5,5-dimethyl-4-phenyl-[1]benzosilolo[3,2-d]pyrimidine.
| Compound Name | 2-[4-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-5,5-dimethyl-4-phenyl-[1]benzosilolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 140747498 |
| Molecular Formula | C51H37N5Si |
| Molecular Weight | 747.98 g/mol |
| Exact Mass | 747.28 |
| IUPAC Name | 2-[4-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-5,5-dimethyl-4-phenyl-[1]benzosilolo[3,2-d]pyrimidine |
| SMILES | C[Si]1(C)c2ccccc2-c2nc(-c3ccc(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c4)cc3)nc(-c3ccccc3)c21 |
| InChI | InChI=1S/C51H37N5Si/c1-57(2)44-27-13-12-26-43(44)46-47(57)45(35-16-6-3-7-17-35)52-48(53-46)38-30-28-34(29-31-38)39-22-14-23-40(32-39)41-24-15-25-42(33-41)51-55-49(36-18-8-4-9-19-36)54-50(56-51)37-20-10-5-11-21-37/h3-33H,1-2H3 |
| InChIKey | QCMNHAUBUYNFMV-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.98 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|