C42H32N2Si — CID 140763856
4-(3,5-diphenylphenyl)-5,5-dimethyl-2-(4-phenylphenyl)-[1]benzosilolo[3,2-d]pyrimidine (PubChem CID 140763856) has the molecular formula C42H32N2Si and a molecular weight of 592.82 g/mol. Its IUPAC name is 4-(3,5-diphenylphenyl)-5,5-dimethyl-2-(4-phenylphenyl)-[1]benzosilolo[3,2-d]pyrimidine.
| Compound Name | 4-(3,5-diphenylphenyl)-5,5-dimethyl-2-(4-phenylphenyl)-[1]benzosilolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 140763856 |
| Molecular Formula | C42H32N2Si |
| Molecular Weight | 592.82 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 4-(3,5-diphenylphenyl)-5,5-dimethyl-2-(4-phenylphenyl)-[1]benzosilolo[3,2-d]pyrimidine |
| SMILES | C[Si]1(C)c2ccccc2-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c21 |
| InChI | InChI=1S/C42H32N2Si/c1-45(2)38-21-13-12-20-37(38)40-41(45)39(43-42(44-40)33-24-22-32(23-25-33)29-14-6-3-7-15-29)36-27-34(30-16-8-4-9-17-30)26-35(28-36)31-18-10-5-11-19-31/h3-28H,1-2H3 |
| InChIKey | XCFGIALBVIRCGS-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.82 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|