C48H38N2Si2 — CID 140763865
[3-[3-(5,5-dimethyl-4-phenyl-[1]benzosilolo[3,2-d]pyrimidin-2-yl)phenyl]phenyl]-triphenylsilane (PubChem CID 140763865) has the molecular formula C48H38N2Si2 and a molecular weight of 699.02 g/mol. Its IUPAC name is [3-[3-(5,5-dimethyl-4-phenyl-[1]benzosilolo[3,2-d]pyrimidin-2-yl)phenyl]phenyl]-triphenylsilane.
| Compound Name | [3-[3-(5,5-dimethyl-4-phenyl-[1]benzosilolo[3,2-d]pyrimidin-2-yl)phenyl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 140763865 |
| Molecular Formula | C48H38N2Si2 |
| Molecular Weight | 699.02 g/mol |
| Exact Mass | 698.26 |
| IUPAC Name | [3-[3-(5,5-dimethyl-4-phenyl-[1]benzosilolo[3,2-d]pyrimidin-2-yl)phenyl]phenyl]-triphenylsilane |
| SMILES | C[Si]1(C)c2ccccc2-c2nc(-c3cccc(-c4cccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)c4)c3)nc(-c3ccccc3)c21 |
| InChI | InChI=1S/C48H38N2Si2/c1-51(2)44-32-16-15-31-43(44)46-47(51)45(35-19-7-3-8-20-35)49-48(50-46)38-23-17-21-36(33-38)37-22-18-30-42(34-37)52(39-24-9-4-10-25-39,40-26-11-5-12-27-40)41-28-13-6-14-29-41/h3-34H,1-2H3 |
| InChIKey | QBBVCHDBMVAFCI-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.02 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|