C55H40N2Si — CID 140763881
5,5-dimethyl-4-phenyl-2-[3-[3-[3-(9-phenylfluoren-9-yl)phenyl]phenyl]phenyl]-[1]benzosilolo[3,2-d]pyrimidine (PubChem CID 140763881) has the molecular formula C55H40N2Si and a molecular weight of 757.03 g/mol. Its IUPAC name is 5,5-dimethyl-4-phenyl-2-[3-[3-[3-(9-phenylfluoren-9-yl)phenyl]phenyl]phenyl]-[1]benzosilolo[3,2-d]pyrimidine.
| Compound Name | 5,5-dimethyl-4-phenyl-2-[3-[3-[3-(9-phenylfluoren-9-yl)phenyl]phenyl]phenyl]-[1]benzosilolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 140763881 |
| Molecular Formula | C55H40N2Si |
| Molecular Weight | 757.03 g/mol |
| Exact Mass | 756.30 |
| IUPAC Name | 5,5-dimethyl-4-phenyl-2-[3-[3-[3-(9-phenylfluoren-9-yl)phenyl]phenyl]phenyl]-[1]benzosilolo[3,2-d]pyrimidine |
| SMILES | C[Si]1(C)c2ccccc2-c2nc(-c3cccc(-c4cccc(-c5cccc(C6(c7ccccc7)c7ccccc7-c7ccccc76)c5)c4)c3)nc(-c3ccccc3)c21 |
| InChI | InChI=1S/C55H40N2Si/c1-58(2)50-33-14-11-30-47(50)52-53(58)51(37-18-5-3-6-19-37)56-54(57-52)42-24-16-22-40(35-42)38-20-15-21-39(34-38)41-23-17-27-44(36-41)55(43-25-7-4-8-26-43)48-31-12-9-28-45(48)46-29-10-13-32-49(46)55/h3-36H,1-2H3 |
| InChIKey | DXZBTMJFXNELJA-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.03 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|