C48H34N2OSi — CID 154010464
2-(3-dibenzofuran-4-ylphenyl)-5,5-dimethyl-4-[3-(3-phenylphenyl)phenyl]-[1]benzosilolo[3,2-d]pyrimidine (PubChem CID 154010464) has the molecular formula C48H34N2OSi and a molecular weight of 682.90 g/mol. Its IUPAC name is 2-(3-dibenzofuran-4-ylphenyl)-5,5-dimethyl-4-[3-(3-phenylphenyl)phenyl]-[1]benzosilolo[3,2-d]pyrimidine.
| Compound Name | 2-(3-dibenzofuran-4-ylphenyl)-5,5-dimethyl-4-[3-(3-phenylphenyl)phenyl]-[1]benzosilolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 154010464 |
| Molecular Formula | C48H34N2OSi |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.24 |
| IUPAC Name | 2-(3-dibenzofuran-4-ylphenyl)-5,5-dimethyl-4-[3-(3-phenylphenyl)phenyl]-[1]benzosilolo[3,2-d]pyrimidine |
| SMILES | C[Si]1(C)c2ccccc2-c2nc(-c3cccc(-c4cccc5c4oc4ccccc45)c3)nc(-c3cccc(-c4cccc(-c5ccccc5)c4)c3)c21 |
| InChI | InChI=1S/C48H34N2OSi/c1-52(2)43-27-9-7-23-41(43)45-47(52)44(36-20-11-18-34(29-36)33-17-10-16-32(28-33)31-14-4-3-5-15-31)49-48(50-45)37-21-12-19-35(30-37)38-24-13-25-40-39-22-6-8-26-42(39)51-46(38)40/h3-30H,1-2H3 |
| InChIKey | JBIYQIGZEABYCI-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|