C38H28N2Si — CID 140785734
17,17-dimethyl-14-naphthalen-1-yl-12-(3-phenylphenyl)-13,15-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 140785734) has the molecular formula C38H28N2Si and a molecular weight of 540.74 g/mol. Its IUPAC name is 17,17-dimethyl-14-naphthalen-1-yl-12-(3-phenylphenyl)-13,15-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | 17,17-dimethyl-14-naphthalen-1-yl-12-(3-phenylphenyl)-13,15-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 140785734 |
| Molecular Formula | C38H28N2Si |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 17,17-dimethyl-14-naphthalen-1-yl-12-(3-phenylphenyl)-13,15-diaza-17-silatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C[Si]1(C)c2cc3ccccc3cc2-c2c(-c3cccc(-c4ccccc4)c3)nc(-c3cccc4ccccc34)nc21 |
| InChI | InChI=1S/C38H28N2Si/c1-41(2)34-24-29-16-7-6-15-28(29)23-33(34)35-36(30-19-10-18-27(22-30)25-12-4-3-5-13-25)39-37(40-38(35)41)32-21-11-17-26-14-8-9-20-31(26)32/h3-24H,1-2H3 |
| InChIKey | WRAMZNWNSSSNOU-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|