C31H28N2 — CID 166501434
6-(4-tert-butylnaphthalen-2-yl)-4-(4-phenylphenyl)-3-(trideuteriomethyl)pyridazine (PubChem CID 166501434) has the molecular formula C31H28N2 and a molecular weight of 431.60 g/mol. Its IUPAC name is 6-(4-tert-butylnaphthalen-2-yl)-4-(4-phenylphenyl)-3-(trideuteriomethyl)pyridazine.
| Compound Name | 6-(4-tert-butylnaphthalen-2-yl)-4-(4-phenylphenyl)-3-(trideuteriomethyl)pyridazine |
|---|---|
| PubChem CID | 166501434 |
| Molecular Formula | C31H28N2 |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 6-(4-tert-butylnaphthalen-2-yl)-4-(4-phenylphenyl)-3-(trideuteriomethyl)pyridazine |
| SMILES | [2H]C([2H])([2H])c1nnc(-c2cc(C(C)(C)C)c3ccccc3c2)cc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28N2/c1-21-28(24-16-14-23(15-17-24)22-10-6-5-7-11-22)20-30(33-32-21)26-18-25-12-8-9-13-27(25)29(19-26)31(2,3)4/h5-20H,1-4H3/i1D3 |
| InChIKey | HDBDRAAWBWJRCL-FIBGUPNXSA-N |
| XLogP | 8.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |