C28H23F3N2 — CID 155760281
1-(4-tert-butylnaphthalen-2-yl)-4-methyl-5-(trifluoromethyl)benzo[g]phthalazine (PubChem CID 155760281) has the molecular formula C28H23F3N2 and a molecular weight of 444.50 g/mol. Its IUPAC name is 1-(4-tert-butylnaphthalen-2-yl)-4-methyl-5-(trifluoromethyl)benzo[g]phthalazine.
| Compound Name | 1-(4-tert-butylnaphthalen-2-yl)-4-methyl-5-(trifluoromethyl)benzo[g]phthalazine |
|---|---|
| PubChem CID | 155760281 |
| Molecular Formula | C28H23F3N2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-(4-tert-butylnaphthalen-2-yl)-4-methyl-5-(trifluoromethyl)benzo[g]phthalazine |
| SMILES | Cc1nnc(-c2cc(C(C)(C)C)c3ccccc3c2)c2cc3ccccc3c(C(F)(F)F)c12 |
| InChI | InChI=1S/C28H23F3N2/c1-16-24-22(14-18-10-6-8-12-21(18)25(24)28(29,30)31)26(33-32-16)19-13-17-9-5-7-11-20(17)23(15-19)27(2,3)4/h5-15H,1-4H3 |
| InChIKey | YVWFIOFJULHYQU-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|