C27H21N3 — CID 163364379
4-(4-tert-butylnaphthalen-2-yl)benzo[g]quinazoline-10-carbonitrile (PubChem CID 163364379) has the molecular formula C27H21N3 and a molecular weight of 387.49 g/mol. Its IUPAC name is 4-(4-tert-butylnaphthalen-2-yl)benzo[g]quinazoline-10-carbonitrile.
| Compound Name | 4-(4-tert-butylnaphthalen-2-yl)benzo[g]quinazoline-10-carbonitrile |
|---|---|
| PubChem CID | 163364379 |
| Molecular Formula | C27H21N3 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-(4-tert-butylnaphthalen-2-yl)benzo[g]quinazoline-10-carbonitrile |
| SMILES | CC(C)(C)c1cc(-c2ncnc3c(C#N)c4ccccc4cc23)cc2ccccc12 |
| InChI | InChI=1S/C27H21N3/c1-27(2,3)24-14-19(12-17-8-5-7-11-21(17)24)25-22-13-18-9-4-6-10-20(18)23(15-28)26(22)30-16-29-25/h4-14,16H,1-3H3 |
| InChIKey | ADUOBSCTVPTFMX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|