C26H21N3S — CID 164783347
4-(4-tert-butylnaphthalen-2-yl)-7-isocyano-6-methyl-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 164783347) has the molecular formula C26H21N3S and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-(4-tert-butylnaphthalen-2-yl)-7-isocyano-6-methyl-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 4-(4-tert-butylnaphthalen-2-yl)-7-isocyano-6-methyl-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 164783347 |
| Molecular Formula | C26H21N3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 4-(4-tert-butylnaphthalen-2-yl)-7-isocyano-6-methyl-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | [C-]#[N+]c1ccc2c(sc3c(-c4cc(C(C)(C)C)c5ccccc5c4)ncnc32)c1C |
| InChI | InChI=1S/C26H21N3S/c1-15-21(27-5)11-10-19-23-25(30-24(15)19)22(28-14-29-23)17-12-16-8-6-7-9-18(16)20(13-17)26(2,3)4/h6-14H,1-4H3 |
| InChIKey | BNUBGEZVDWYXLN-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|