C31H30N2SSi — CID 176748895
4-(4-tert-butylnaphthalen-2-yl)-6-(1,1-dimethyl-1-benzosilol-5-yl)-7-methylthieno[3,2-d]pyrimidine (PubChem CID 176748895) has the molecular formula C31H30N2SSi and a molecular weight of 490.75 g/mol. Its IUPAC name is 4-(4-tert-butylnaphthalen-2-yl)-6-(1,1-dimethyl-1-benzosilol-5-yl)-7-methylthieno[3,2-d]pyrimidine.
| Compound Name | 4-(4-tert-butylnaphthalen-2-yl)-6-(1,1-dimethyl-1-benzosilol-5-yl)-7-methylthieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 176748895 |
| Molecular Formula | C31H30N2SSi |
| Molecular Weight | 490.75 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 4-(4-tert-butylnaphthalen-2-yl)-6-(1,1-dimethyl-1-benzosilol-5-yl)-7-methylthieno[3,2-d]pyrimidine |
| SMILES | Cc1c(-c2ccc3c(c2)C=C[Si]3(C)C)sc2c(-c3cc(C(C)(C)C)c4ccccc4c3)ncnc12 |
| InChI | InChI=1S/C31H30N2SSi/c1-19-27-30(34-29(19)22-11-12-26-21(16-22)13-14-35(26,5)6)28(33-18-32-27)23-15-20-9-7-8-10-24(20)25(17-23)31(2,3)4/h7-18H,1-6H3 |
| InChIKey | HVUVNNKIVPBTKZ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.75 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|