C34H33NOSi — CID 171764340
[4-[1-(4-tert-butylnaphthalen-2-yl)-[1]benzofuro[3,2-c]pyridin-6-yl]phenyl]-trimethylsilane (PubChem CID 171764340) has the molecular formula C34H33NOSi and a molecular weight of 499.73 g/mol. Its IUPAC name is [4-[1-(4-tert-butylnaphthalen-2-yl)-[1]benzofuro[3,2-c]pyridin-6-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[1-(4-tert-butylnaphthalen-2-yl)-[1]benzofuro[3,2-c]pyridin-6-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 171764340 |
| Molecular Formula | C34H33NOSi |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | [4-[1-(4-tert-butylnaphthalen-2-yl)-[1]benzofuro[3,2-c]pyridin-6-yl]phenyl]-trimethylsilane |
| SMILES | CC(C)(C)c1cc(-c2nccc3oc4c(-c5ccc([Si](C)(C)C)cc5)cccc4c23)cc2ccccc12 |
| InChI | InChI=1S/C34H33NOSi/c1-34(2,3)29-21-24(20-23-10-7-8-11-26(23)29)32-31-28-13-9-12-27(33(28)36-30(31)18-19-35-32)22-14-16-25(17-15-22)37(4,5)6/h7-21H,1-6H3 |
| InChIKey | DQPHFHRXPVZSSO-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|