C37H28F3NSi — CID 177091525
trimethyl-[4-[1-[4-(trifluoromethyl)naphthalen-2-yl]naphtho[2,1-f]isoquinolin-8-yl]phenyl]silane (PubChem CID 177091525) has the molecular formula C37H28F3NSi and a molecular weight of 571.72 g/mol. Its IUPAC name is trimethyl-[4-[1-[4-(trifluoromethyl)naphthalen-2-yl]naphtho[2,1-f]isoquinolin-8-yl]phenyl]silane.
| Compound Name | trimethyl-[4-[1-[4-(trifluoromethyl)naphthalen-2-yl]naphtho[2,1-f]isoquinolin-8-yl]phenyl]silane |
|---|---|
| PubChem CID | 177091525 |
| Molecular Formula | C37H28F3NSi |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | trimethyl-[4-[1-[4-(trifluoromethyl)naphthalen-2-yl]naphtho[2,1-f]isoquinolin-8-yl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc3c(ccc4c5ccnc(-c6cc(C(F)(F)F)c7ccccc7c6)c5ccc34)c2)cc1 |
| InChI | InChI=1S/C37H28F3NSi/c1-42(2,3)28-12-8-23(9-13-28)24-10-14-29-26(20-24)11-15-32-31(29)16-17-34-33(32)18-19-41-36(34)27-21-25-6-4-5-7-30(25)35(22-27)37(38,39)40/h4-22H,1-3H3 |
| InChIKey | QPIROOJJQMINRE-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|