C33H35NO5S — CID 170679070
5-tert-butyl-7-(4,4,7,7-tetramethyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaen-15-yl)naphthalene-1,2,3,4,6-pentol (PubChem CID 170679070) has the molecular formula C33H35NO5S and a molecular weight of 557.71 g/mol. Its IUPAC name is 5-tert-butyl-7-(4,4,7,7-tetramethyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaen-15-yl)naphthalene-1,2,3,4,6-pentol.
| Compound Name | 5-tert-butyl-7-(4,4,7,7-tetramethyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaen-15-yl)naphthalene-1,2,3,4,6-pentol |
|---|---|
| PubChem CID | 170679070 |
| Molecular Formula | C33H35NO5S |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 5-tert-butyl-7-(4,4,7,7-tetramethyl-17-thia-14-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaen-15-yl)naphthalene-1,2,3,4,6-pentol |
| SMILES | CC(C)(C)c1c(O)c(-c2nccc3c2sc2cc4c(cc23)C(C)(C)CCC4(C)C)cc2c(O)c(O)c(O)c(O)c12 |
| InChI | InChI=1S/C33H35NO5S/c1-31(2,3)23-22-17(26(36)28(38)29(39)27(22)37)12-18(25(23)35)24-30-15(8-11-34-24)16-13-19-20(14-21(16)40-30)33(6,7)10-9-32(19,4)5/h8,11-14,35-39H,9-10H2,1-7H3 |
| InChIKey | BUDURIWPNNOUPG-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|