C17H23NS — CID 70834312
(Z)-N-[(1R)-1-(1-benzothiophen-3-yl)ethyl]-4,4-dimethylpent-2-en-1-amine (PubChem CID 70834312) has the molecular formula C17H23NS and a molecular weight of 273.44 g/mol. Its IUPAC name is (Z)-N-[(1R)-1-(1-benzothiophen-3-yl)ethyl]-4,4-dimethylpent-2-en-1-amine.
| Compound Name | (Z)-N-[(1R)-1-(1-benzothiophen-3-yl)ethyl]-4,4-dimethylpent-2-en-1-amine |
|---|---|
| PubChem CID | 70834312 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (Z)-N-[(1R)-1-(1-benzothiophen-3-yl)ethyl]-4,4-dimethylpent-2-en-1-amine |
| SMILES | C[C@@H](NC/C=C\C(C)(C)C)c1csc2ccccc12 |
| InChI | InChI=1S/C17H23NS/c1-13(18-11-7-10-17(2,3)4)15-12-19-16-9-6-5-8-14(15)16/h5-10,12-13,18H,11H2,1-4H3/b10-7-/t13-/m1/s1 |
| InChIKey | FYBGICXCCLEQDY-PGJNLMOESA-N |
| XLogP | 5.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|