C19H25NO — CID 70834153
(E)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-en-1-ol (PubChem CID 70834153) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is (E)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-en-1-ol.
| Compound Name | (E)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-en-1-ol |
|---|---|
| PubChem CID | 70834153 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (E)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-en-1-ol |
| SMILES | C[C@@H](NC/C=C/C(C)(C)CO)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H25NO/c1-15(20-13-7-12-19(2,3)14-21)17-11-6-9-16-8-4-5-10-18(16)17/h4-12,15,20-21H,13-14H2,1-3H3/b12-7+/t15-/m1/s1 |
| InChIKey | SSMDZCMRXOQHTM-CUXKMMBLSA-N |
| XLogP | 4.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|