About benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate
benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate (PubChem CID 70834358) has the molecular formula C26H29NO2
and a molecular weight of 387.52 g/mol. Its IUPAC name is benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate.
Molecular Properties
| Compound Name | benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate |
| PubChem CID | 70834358 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate |
| SMILES | C[C@@H](NC/C=C\C(C)(C)C(=O)OCc1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H29NO2/c1-20(23-16-9-14-22-13-7-8-15-24(22)23)27-18-10-17-26(2,3)25(28)29-19-21-11-5-4-6-12-21/h4-17,20,27H,18-19H2,1-3H3/b17-10-/t20-/m1/s1 |
| InChIKey | PVPFNNNDNLEDLB-PLMLNFJUSA-N |
| XLogP | 5.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate?
The IUPAC name of benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate (CID 70834358) is benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate.
What is the SMILES notation for benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate?
The canonical SMILES for benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate is C[C@@H](NC/C=C\C(C)(C)C(=O)OCc1ccccc1)c1cccc2ccccc12.
What is the InChIKey of benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate?
The InChIKey is PVPFNNNDNLEDLB-PLMLNFJUSA-N. The full InChI is InChI=1S/C26H29NO2/c1-20(23-16-9-14-22-13-7-8-15-24(22)23)27-18-10-17-26(2,3)25(28)29-19-21-11-5-4-6-12-21/h4-17,20,27H,18-19H2,1-3H3/b17-10-/t20-/m1/s1.
What are the key properties of benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate?
benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate has a molecular weight of 387.52 g/mol, XLogP of 5.82, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (Z)-2,2-dimethyl-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enoate is sourced from PubChem (CID 70834358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).