C21H27NO2 — CID 70834224
methyl (E)-2,2-dimethyl-6-[[(1R)-1-naphthalen-1-ylethyl]amino]hex-4-enoate (PubChem CID 70834224) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is methyl (E)-2,2-dimethyl-6-[[(1R)-1-naphthalen-1-ylethyl]amino]hex-4-enoate.
| Compound Name | methyl (E)-2,2-dimethyl-6-[[(1R)-1-naphthalen-1-ylethyl]amino]hex-4-enoate |
|---|---|
| PubChem CID | 70834224 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | methyl (E)-2,2-dimethyl-6-[[(1R)-1-naphthalen-1-ylethyl]amino]hex-4-enoate |
| SMILES | COC(=O)C(C)(C)C/C=C/CN[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H27NO2/c1-16(18-13-9-11-17-10-5-6-12-19(17)18)22-15-8-7-14-21(2,3)20(23)24-4/h5-13,16,22H,14-15H2,1-4H3/b8-7+/t16-/m1/s1 |
| InChIKey | MTFQIGNKRIGJRA-KXPUMZMLSA-N |
| XLogP | 4.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|