C21H29N3O — CID 70834351
1-[(E)-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enyl]-3-propylurea (PubChem CID 70834351) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-[(E)-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enyl]-3-propylurea.
| Compound Name | 1-[(E)-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enyl]-3-propylurea |
|---|---|
| PubChem CID | 70834351 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 1-[(E)-5-[[(1R)-1-naphthalen-1-ylethyl]amino]pent-3-enyl]-3-propylurea |
| SMILES | CCCNC(=O)NCC/C=C/CN[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H29N3O/c1-3-14-23-21(25)24-16-8-4-7-15-22-17(2)19-13-9-11-18-10-5-6-12-20(18)19/h4-7,9-13,17,22H,3,8,14-16H2,1-2H3,(H2,23,24,25)/b7-4+/t17-/m1/s1 |
| InChIKey | UAVAMZVEDWJCBR-BBOMDTFKSA-N |
| XLogP | 4.15 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|