C24H32N2 — CID 59562927
(E)-N-[(1R)-1-naphthalen-1-ylethyl]-N',N'-dipropylhex-2-en-4-yne-1,6-diamine (PubChem CID 59562927) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is (E)-N-[(1R)-1-naphthalen-1-ylethyl]-N',N'-dipropylhex-2-en-4-yne-1,6-diamine.
| Compound Name | (E)-N-[(1R)-1-naphthalen-1-ylethyl]-N',N'-dipropylhex-2-en-4-yne-1,6-diamine |
|---|---|
| PubChem CID | 59562927 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | (E)-N-[(1R)-1-naphthalen-1-ylethyl]-N',N'-dipropylhex-2-en-4-yne-1,6-diamine |
| SMILES | CCCN(CC#C/C=C/CN[C@H](C)c1cccc2ccccc12)CCC |
| InChI | InChI=1S/C24H32N2/c1-4-18-26(19-5-2)20-11-7-6-10-17-25-21(3)23-16-12-14-22-13-8-9-15-24(22)23/h6,8-10,12-16,21,25H,4-5,17-20H2,1-3H3/b10-6+/t21-/m1/s1 |
| InChIKey | SUXDCSQEHWCMGT-VMLCMGRWSA-N |
| XLogP | 5.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|