C20H24N2 — CID 89294620
(E)-N-[(1R)-1-naphthalen-1-ylethyl]oct-2-en-4-yne-1,8-diamine (PubChem CID 89294620) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (E)-N-[(1R)-1-naphthalen-1-ylethyl]oct-2-en-4-yne-1,8-diamine.
| Compound Name | (E)-N-[(1R)-1-naphthalen-1-ylethyl]oct-2-en-4-yne-1,8-diamine |
|---|---|
| PubChem CID | 89294620 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (E)-N-[(1R)-1-naphthalen-1-ylethyl]oct-2-en-4-yne-1,8-diamine |
| SMILES | C[C@@H](NC/C=C/C#CCCCN)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H24N2/c1-17(22-16-9-5-3-2-4-8-15-21)19-14-10-12-18-11-6-7-13-20(18)19/h5-7,9-14,17,22H,4,8,15-16,21H2,1H3/b9-5+/t17-/m1/s1 |
| InChIKey | RPTCNDWUHQUOPF-HFTQHKIXSA-N |
| XLogP | 3.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|