C23H20FN — CID 25006024
(E)-5-(2-fluorophenyl)-N-[(1R)-1-naphthalen-1-ylethyl]pent-2-en-4-yn-1-amine (PubChem CID 25006024) has the molecular formula C23H20FN and a molecular weight of 329.42 g/mol. Its IUPAC name is (E)-5-(2-fluorophenyl)-N-[(1R)-1-naphthalen-1-ylethyl]pent-2-en-4-yn-1-amine.
| Compound Name | (E)-5-(2-fluorophenyl)-N-[(1R)-1-naphthalen-1-ylethyl]pent-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 25006024 |
| Molecular Formula | C23H20FN |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (E)-5-(2-fluorophenyl)-N-[(1R)-1-naphthalen-1-ylethyl]pent-2-en-4-yn-1-amine |
| SMILES | C[C@@H](NC/C=C/C#Cc1ccccc1F)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H20FN/c1-18(21-15-9-13-19-10-4-6-14-22(19)21)25-17-8-2-3-11-20-12-5-7-16-23(20)24/h2,4-10,12-16,18,25H,17H2,1H3/b8-2+/t18-/m1/s1 |
| InChIKey | OUCZCMRRDPYVEF-ZHLNUILUSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|