C27H30N2O2S — CID 59562872
4-methyl-N-[(E)-8-[[(1R)-1-naphthalen-1-ylethyl]amino]oct-6-en-4-ynyl]benzenesulfonamide (PubChem CID 59562872) has the molecular formula C27H30N2O2S and a molecular weight of 446.62 g/mol. Its IUPAC name is 4-methyl-N-[(E)-8-[[(1R)-1-naphthalen-1-ylethyl]amino]oct-6-en-4-ynyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-8-[[(1R)-1-naphthalen-1-ylethyl]amino]oct-6-en-4-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59562872 |
| Molecular Formula | C27H30N2O2S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 4-methyl-N-[(E)-8-[[(1R)-1-naphthalen-1-ylethyl]amino]oct-6-en-4-ynyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCC#C/C=C/CN[C@H](C)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C27H30N2O2S/c1-22-16-18-25(19-17-22)32(30,31)29-21-10-6-4-3-5-9-20-28-23(2)26-15-11-13-24-12-7-8-14-27(24)26/h5,7-9,11-19,23,28-29H,6,10,20-21H2,1-2H3/b9-5+/t23-/m1/s1 |
| InChIKey | FFCBSPNQJTYDSR-DXSBJVNVSA-N |
| XLogP | 5.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|