C20H24N2S — CID 143626003
(E)-N'-ethylsulfanyl-N-(1-naphthalen-1-ylethyl)hex-2-en-4-yne-1,6-diamine (PubChem CID 143626003) has the molecular formula C20H24N2S and a molecular weight of 324.49 g/mol. Its IUPAC name is (E)-N'-ethylsulfanyl-N-(1-naphthalen-1-ylethyl)hex-2-en-4-yne-1,6-diamine.
| Compound Name | (E)-N'-ethylsulfanyl-N-(1-naphthalen-1-ylethyl)hex-2-en-4-yne-1,6-diamine |
|---|---|
| PubChem CID | 143626003 |
| Molecular Formula | C20H24N2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (E)-N'-ethylsulfanyl-N-(1-naphthalen-1-ylethyl)hex-2-en-4-yne-1,6-diamine |
| SMILES | CCSNCC#C/C=C/CNC(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H24N2S/c1-3-23-22-16-9-5-4-8-15-21-17(2)19-14-10-12-18-11-6-7-13-20(18)19/h4,6-8,10-14,17,21-22H,3,15-16H2,1-2H3/b8-4+ |
| InChIKey | MYHIXYGEMCHGLF-XBXARRHUSA-N |
| XLogP | 4.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|