C30H45NOSi — CID 91196178
6,6-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]-7-tri(propan-2-yl)silyloxyhept-2-en-4-yn-1-amine (PubChem CID 91196178) has the molecular formula C30H45NOSi and a molecular weight of 463.78 g/mol. Its IUPAC name is 6,6-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]-7-tri(propan-2-yl)silyloxyhept-2-en-4-yn-1-amine.
| Compound Name | 6,6-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]-7-tri(propan-2-yl)silyloxyhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 91196178 |
| Molecular Formula | C30H45NOSi |
| Molecular Weight | 463.78 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | 6,6-dimethyl-N-[(1R)-1-naphthalen-1-ylethyl]-7-tri(propan-2-yl)silyloxyhept-2-en-4-yn-1-amine |
| SMILES | CC(C)[Si](OCC(C)(C)C#CC=CCN[C@H](C)c1cccc2ccccc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H45NOSi/c1-23(2)33(24(3)4,25(5)6)32-22-30(8,9)20-13-10-14-21-31-26(7)28-19-15-17-27-16-11-12-18-29(27)28/h10-12,14-19,23-26,31H,21-22H2,1-9H3/t26-/m1/s1 |
| InChIKey | PHDJXNVNBKAGGV-AREMUKBSSA-N |
| XLogP | 8.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.78 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|